Give at least three molecular equations corresponding to the following abbreviated ionic: CaCO3 + 2H +
| June 21, 2021 | education
Give at least three molecular equations corresponding to the following abbreviated ionic: CaCO3 + 2H + = Ca2 + + CO2 + H2O
1) CaCO3+2HCl=CaCl2+CO2+H2O
2) CaCO3+2HNO3=Ca(NO3)2+CO2+H2O
3) Ca(OH)3+2HI=CaI2+CO2+H2O
One of the components of a person's success in our time is receiving modern high-quality education, mastering the knowledge, skills and abilities necessary for life in society. A person today needs to study almost all his life, mastering everything new and new, acquiring the necessary professional qualities.
