Write the reaction equations: FeCl3 ↑ ↓ Fe → Fe2 (SO4) 3 → Fe (OH) 3 ↓ ↑ Fe (NO3) 3
May 10, 2021 | education
| Fe(OH)3 + 3HCl = FeCl3 + 3H2O, FeCl3 + 3KOH = Fe(OH)3↓+ 3KCl
2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
Fe+4HNO3=Fe(NO3)3+2H2O+NO, Fe(NO3)3 + 3KOH = Fe(OH)3 + 3KNO3
One of the components of a person's success in our time is receiving modern high-quality education, mastering the knowledge, skills and abilities necessary for life in society. A person today needs to study almost all his life, mastering everything new and new, acquiring the necessary professional qualities.